CAS 174074-88-5 appears in our catalog under these names: Methyl 2,4–dioxo–1,2,3,4–tetrahydroquinazoline–7–carboxylate, 7-Quinazolinecarboxylic acid, 1,2,3,4-tetrahydro-2,4-dioxo-, Methyl ester, 95%, 95%, Methyl 2,4-dihydroxyquinazoline-7-carboxylate, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 2,4-dioxo-1H-quinazoline-7-carboxylate (CAS 174074-88-5) is a chemical compound with the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. IUPAC name: methyl 2,4-dioxo-1H-quinazoline-7-carboxylate. InChIKey: CZKCZHGGECJJMQ-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O4 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | methyl 2,4-dioxo-1H-quinazoline-7-carboxylate |
| InChIKey | CZKCZHGGECJJMQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)