CAS 17580-64-2 appears in our catalog under these names: 2-((Hydroxyimino)methyl)-6-nitrophenol, 2-[(1E)-(Hydroxyimino)methyl]-6-nitrophenol, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 0,5g, 5g, 10g, 250mg, 100mg, 1g.
2-[(E)-hydroxyiminomethyl]-6-nitrophenol (CAS 17580-64-2) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 2-[(E)-hydroxyiminomethyl]-6-nitrophenol. InChIKey: MTLXRYAXTYRUHQ-XBXARRHUSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 2-[(E)-hydroxyiminomethyl]-6-nitrophenol |
| InChIKey | MTLXRYAXTYRUHQ-XBXARRHUSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])O)/C=N/O |
Computed by PubChem (NCBI)