Products 1782577-37-0
CAS 1782577-37-0 is the registry number for 2-(6-Chloroimidazo[1,2-A]Pyrazin-3-Yl)Propan-2-Ol, ≥95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
2-(6-chloroimidazo[1,2-a]pyrazin-3-yl)propan-2-ol (CAS 1782577-37-0) is a chemical compound with the molecular formula C9H10ClN3O and a molecular weight of 211.65 g/mol. IUPAC name: 2-(6-chloroimidazo[1,2-a]pyrazin-3-yl)propan-2-ol. InChIKey: DQWJIRFSBFBJDJ-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3O |
|---|---|
| Molecular weight | 211.65 g/mol |
| IUPAC name | 2-(6-chloroimidazo[1,2-a]pyrazin-3-yl)propan-2-ol |
| InChIKey | DQWJIRFSBFBJDJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CN=C2N1C=C(N=C2)Cl)O |
Computed by PubChem (NCBI)