Products 1784746-78-6
CAS 1784746-78-6 is the registry number for 1-(Difluoromethoxy)-4-[(1E)-2-nitroethenyl]benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(difluoromethoxy)-4-[(E)-2-nitroethenyl]benzene (CAS 1784746-78-6) is a chemical compound with the molecular formula C9H7F2NO3 and a molecular weight of 215.15 g/mol. IUPAC name: 1-(difluoromethoxy)-4-[(E)-2-nitroethenyl]benzene. InChIKey: FJOLHJUJLYBCPV-AATRIKPKSA-N.
| Molecular formula | C9H7F2NO3 |
|---|---|
| Molecular weight | 215.15 g/mol |
| IUPAC name | 1-(difluoromethoxy)-4-[(E)-2-nitroethenyl]benzene |
| InChIKey | FJOLHJUJLYBCPV-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1/C=C/[N+](=O)[O-])OC(F)F |
Computed by PubChem (NCBI)