Products 17965-79-6
CAS 17965-79-6 appears in our catalog under these names: 3,6-Dibromo-1,8-naphthyridine, 3,6-Dibromo-1,8-naphthyridine, 95+%, 3,6-Dibromo-1,8-naphthyridine, 95%+. Offered by: Biosynth, Ambeed, Chemat, BLDpharm. Available pack sizes: 0,1g, 0,25g, 0,5g, 1g, 2g, 250mg, 5g, 25mg.
3,6-dibromo-1,8-naphthyridine (CAS 17965-79-6) is a chemical compound with the molecular formula C8H4Br2N2 and a molecular weight of 287.94 g/mol. IUPAC name: 3,6-dibromo-1,8-naphthyridine. InChIKey: MSXZKKXCUFRJFQ-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2 |
|---|---|
| Molecular weight | 287.94 g/mol |
| IUPAC name | 3,6-dibromo-1,8-naphthyridine |
| InChIKey | MSXZKKXCUFRJFQ-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(C=NC2=NC=C1Br)Br |
Computed by PubChem (NCBI)