Products 1797933-78-8
CAS 1797933-78-8 appears in our catalog under these names: 1-(2,6-Difluorophenyl)-5-methyl-1H-pyrazole-3-carboxylic acid, 1-(2,6-Difluorophenyl)-5-methyl-1H-pyrazole-3-carboxylic acid, 95%. Offered by: Biosynth, Ambeed, BLDpharm. Available pack sizes: 0,5g, 50mg, 250mg, 1g, 100mg, 5g.
1-(2,6-difluorophenyl)-5-methylpyrazole-3-carboxylic acid (CAS 1797933-78-8) is a chemical compound with the molecular formula C11H8F2N2O2 and a molecular weight of 238.19 g/mol. IUPAC name: 1-(2,6-difluorophenyl)-5-methylpyrazole-3-carboxylic acid. InChIKey: UHYQXGQALYJYRL-UHFFFAOYSA-N.
| Molecular formula | C11H8F2N2O2 |
|---|---|
| Molecular weight | 238.19 g/mol |
| IUPAC name | 1-(2,6-difluorophenyl)-5-methylpyrazole-3-carboxylic acid |
| InChIKey | UHYQXGQALYJYRL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=C(C=CC=C2F)F)C(=O)O |
Computed by PubChem (NCBI)