CAS 1799667-33-6 is the registry number for α-Amylase-IN-12. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4Z)-4-[(3,4-dihydroxyphenyl)methylidene]-2-phenyl-1,3-oxazol-5-one (CAS 1799667-33-6) is a chemical compound with the molecular formula C16H11NO4 and a molecular weight of 281.26 g/mol. IUPAC name: (4Z)-4-[(3,4-dihydroxyphenyl)methylidene]-2-phenyl-1,3-oxazol-5-one. InChIKey: MYSOXERGEXUHQJ-WQLSENKSSA-N.
| Molecular formula | C16H11NO4 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | (4Z)-4-[(3,4-dihydroxyphenyl)methylidene]-2-phenyl-1,3-oxazol-5-one |
| InChIKey | MYSOXERGEXUHQJ-WQLSENKSSA-N |
| SMILES | C1=CC=C(C=C1)C2=N/C(=C\C3=CC(=C(C=C3)O)O)/C(=O)O2 |
Computed by PubChem (NCBI)