CAS 1803587-90-7 is the registry number for 4-Phenyl-4H-1,2,4-triazol-3-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-phenyl-1,2,4-triazol-3-amine;hydrochloride (CAS 1803587-90-7) is a chemical compound with the molecular formula C8H9ClN4 and a molecular weight of 196.64 g/mol. IUPAC name: 4-phenyl-1,2,4-triazol-3-amine;hydrochloride. InChIKey: QZMVVRTXXCITEO-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN4 |
|---|---|
| Molecular weight | 196.64 g/mol |
| IUPAC name | 4-phenyl-1,2,4-triazol-3-amine;hydrochloride |
| InChIKey | QZMVVRTXXCITEO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=NN=C2N.Cl |
Computed by PubChem (NCBI)