Products 1803591-99-2
CAS 1803591-99-2 is the registry number for Methyl 4-(1-amino-2,2,2-trifluoroethyl)benzoate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 4-(1-amino-2,2,2-trifluoroethyl)benzoate;hydrochloride (CAS 1803591-99-2) is a chemical compound with the molecular formula C10H11ClF3NO2 and a molecular weight of 269.65 g/mol. IUPAC name: methyl 4-(1-amino-2,2,2-trifluoroethyl)benzoate;hydrochloride. InChIKey: LDRZDPNCSRXYGJ-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3NO2 |
|---|---|
| Molecular weight | 269.65 g/mol |
| IUPAC name | methyl 4-(1-amino-2,2,2-trifluoroethyl)benzoate;hydrochloride |
| InChIKey | LDRZDPNCSRXYGJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C(C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)