Products 1805583-62-3
CAS 1805583-62-3 appears in our catalog under these names: Ethyl 3-bromo-2,4-difluorobenzoate, ≥99.6%, Ethyl 3-bromo-2,4-difluorobenzoate, ≥95%, ≥95%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g.
Ethyl 3-bromo-2,4-difluorobenzoate (CAS 1805583-62-3) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: ethyl 3-bromo-2,4-difluorobenzoate. InChIKey: ZVLLZRSPVUMKGS-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | ethyl 3-bromo-2,4-difluorobenzoate |
| InChIKey | ZVLLZRSPVUMKGS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(C=C1)F)Br)F |
Computed by PubChem (NCBI)