Products 1822649-00-2
CAS 1822649-00-2 is the registry number for 4,5,6,7-Tetrahydro-5-methyl-4-oxothieno[3,2-c]pyridine-2-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
5-methyl-4-oxo-6,7-dihydrothieno[3,2-c]pyridine-2-carboxylic acid (CAS 1822649-00-2) is a chemical compound with the molecular formula C9H9NO3S and a molecular weight of 211.24 g/mol. IUPAC name: 5-methyl-4-oxo-6,7-dihydrothieno[3,2-c]pyridine-2-carboxylic acid. InChIKey: VJLAJULMPJUAKO-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3S |
|---|---|
| Molecular weight | 211.24 g/mol |
| IUPAC name | 5-methyl-4-oxo-6,7-dihydrothieno[3,2-c]pyridine-2-carboxylic acid |
| InChIKey | VJLAJULMPJUAKO-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(C1=O)C=C(S2)C(=O)O |
Computed by PubChem (NCBI)