Products 1823586-68-0
CAS 1823586-68-0 is the registry number for 6-(tert-Butyl) 2-methyl 4,7-dihydrothieno[2,3-c]pyridine-2,6(5H)-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-O-tert-butyl 2-O-methyl 5,7-dihydro-4H-thieno[2,3-c]pyridine-2,6-dicarboxylate (CAS 1823586-68-0) is a chemical compound with the molecular formula C14H19NO4S and a molecular weight of 297.37 g/mol. IUPAC name: 6-O-tert-butyl 2-O-methyl 5,7-dihydro-4H-thieno[2,3-c]pyridine-2,6-dicarboxylate. InChIKey: YHNCCARVXMZMMG-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4S |
|---|---|
| Molecular weight | 297.37 g/mol |
| IUPAC name | 6-O-tert-butyl 2-O-methyl 5,7-dihydro-4H-thieno[2,3-c]pyridine-2,6-dicarboxylate |
| InChIKey | YHNCCARVXMZMMG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)SC(=C2)C(=O)OC |
Computed by PubChem (NCBI)