CAS 1823833-59-5 appears in our catalog under these names: 1,4-Bis(tert-butoxycarbonyl)-2-methylpiperazine-2-carboxylic acid, 98%, 1,4-Bis(tert-butoxycarbonyl)-2-methylpiperazine-2-carboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g.
2-methyl-1,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid (CAS 1823833-59-5) is a chemical compound with the molecular formula C16H28N2O6 and a molecular weight of 344.40 g/mol. IUPAC name: 2-methyl-1,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid. InChIKey: HEKFEZMRZDBUKG-UHFFFAOYSA-N.
| Molecular formula | C16H28N2O6 |
|---|---|
| Molecular weight | 344.40 g/mol |
| IUPAC name | 2-methyl-1,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid |
| InChIKey | HEKFEZMRZDBUKG-UHFFFAOYSA-N |
| SMILES | CC1(CN(CCN1C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)