CAS 1846-29-3 appears in our catalog under these names: 2-Methyl-1,3-diphenylpropane-1,3-dione, 98%, 2-Methyl-1,3-diphenylpropane-1,3-dione, 2-Methyl-1,3-diphenylpropane-1,3-dione, 98%, 98%, 3-hydroxy-2-methyl-1,3-diphenylprop-2-en-1-one, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 0,5g, 100mg, 250mg, 500mg, 1g, 2.5g.
2-methyl-1,3-diphenylpropane-1,3-dione (CAS 1846-29-3) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: 2-methyl-1,3-diphenylpropane-1,3-dione. InChIKey: ONGBXISBKSVVFS-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 2-methyl-1,3-diphenylpropane-1,3-dione |
| InChIKey | ONGBXISBKSVVFS-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=CC=C1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)