CAS 1889841-88-6 appears in our catalog under these names: 4,6-Dibromoisoquinoline, 98%, 4,6-Dibromoisoquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4,6-dibromoisoquinoline (CAS 1889841-88-6) is a chemical compound with the molecular formula C9H5Br2N and a molecular weight of 286.95 g/mol. IUPAC name: 4,6-dibromoisoquinoline. InChIKey: WLXBEBYSRQOBKV-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2N |
|---|---|
| Molecular weight | 286.95 g/mol |
| IUPAC name | 4,6-dibromoisoquinoline |
| InChIKey | WLXBEBYSRQOBKV-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=CC(=C2C=C1Br)Br |
Computed by PubChem (NCBI)