Products 19062-17-0
CAS 19062-17-0 is the registry number for 2-Amino-1-(2,6-dichlorophenyl)ethan-1-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-amino-1-(2,6-dichlorophenyl)ethanol;hydrochloride (CAS 19062-17-0) is a chemical compound with the molecular formula C8H10Cl3NO and a molecular weight of 242.5 g/mol. IUPAC name: 2-amino-1-(2,6-dichlorophenyl)ethanol;hydrochloride. InChIKey: LFQSNQWKWXJHBH-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3NO |
|---|---|
| Molecular weight | 242.5 g/mol |
| IUPAC name | 2-amino-1-(2,6-dichlorophenyl)ethanol;hydrochloride |
| InChIKey | LFQSNQWKWXJHBH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(CN)O)Cl.Cl |
Computed by PubChem (NCBI)