CAS 194804-94-9 appears in our catalog under these names: 4-Bromo-3-chloro-2-fluorobenzoic acid, 4-Bromo-3-chloro-2-fluorobenzoic acid, 98%, 98%, 4-Bromo-3-chloro-2-fluorobenzoic acid, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g.
4-bromo-3-chloro-2-fluorobenzoic acid (CAS 194804-94-9) is a chemical compound with the molecular formula C7H3BrClFO2 and a molecular weight of 253.45 g/mol. IUPAC name: 4-bromo-3-chloro-2-fluorobenzoic acid. InChIKey: KPMQBAAFCDKHGV-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO2 |
|---|---|
| Molecular weight | 253.45 g/mol |
| IUPAC name | 4-bromo-3-chloro-2-fluorobenzoic acid |
| InChIKey | KPMQBAAFCDKHGV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)F)Cl)Br |
Computed by PubChem (NCBI)