CAS 1956370-82-3 is the registry number for 3,7-Dibromocinnoline, 98%. Offered by: AmBeed. Available pack sizes: 1g.
3,7-dibromocinnoline (CAS 1956370-82-3) is a chemical compound with the molecular formula C8H4Br2N2 and a molecular weight of 287.94 g/mol. IUPAC name: 3,7-dibromocinnoline. InChIKey: LDMMIMRFSUFLJL-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2 |
|---|---|
| Molecular weight | 287.94 g/mol |
| IUPAC name | 3,7-dibromocinnoline |
| InChIKey | LDMMIMRFSUFLJL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=NN=C(C=C21)Br)Br |
Computed by PubChem (NCBI)