CAS 195986-91-5 appears in our catalog under these names: 5–Hydroxy isatoic anhydride, 5-Hydroxy isatoic anhydride, 97%, 6-Hydroxy-1H-benzo(d)(1,3)oxazine-2,4-dione, 6-Hydroxy-1H-benzo[d][1,3]oxazine-2,4-dione, 97%, 97%, 6-Hydroxy-1H-benzo[d][1,3]oxazine-2,4-dione, 97%. Offered by: GLPBio, Fluorochem, Biosynth, Chemat, Ambeed. Available pack sizes: 1g, 5g, 2,5g, 0,25g, 250mg, 25g.
6-hydroxy-1H-3,1-benzoxazine-2,4-dione (CAS 195986-91-5) is a chemical compound with the molecular formula C8H5NO4 and a molecular weight of 179.13 g/mol. IUPAC name: 6-hydroxy-1H-3,1-benzoxazine-2,4-dione. InChIKey: JYDXUDOZEQAXBH-UHFFFAOYSA-N.
| Molecular formula | C8H5NO4 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 6-hydroxy-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | JYDXUDOZEQAXBH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C(=O)OC(=O)N2 |
Computed by PubChem (NCBI)