Products 196106-35-1
CAS 196106-35-1 appears in our catalog under these names: methyl (E)–3–((1，1'–biphenyl)–3–yl)acrylate, Methyl (E)-3-([1,1'-biphenyl]-3-yl)acrylate, 98%, 98%, Methyl (E)-3-([1,1'-biphenyl]-3-yl)acrylate, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
Methyl (E)-3-(3-phenylphenyl)prop-2-enoate (CAS 196106-35-1) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: methyl (E)-3-(3-phenylphenyl)prop-2-enoate. InChIKey: KCVJXVYRQXJNDD-ZHACJKMWSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | methyl (E)-3-(3-phenylphenyl)prop-2-enoate |
| InChIKey | KCVJXVYRQXJNDD-ZHACJKMWSA-N |
| SMILES | COC(=O)/C=C/C1=CC(=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)