Products 1965314-54-8
CAS 1965314-54-8 is the registry number for (S)-2-Amino-1-(3,4-dichloro-phenyl)-ethanol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1S)-2-amino-1-(3,4-dichlorophenyl)ethanol;hydrochloride (CAS 1965314-54-8) is a chemical compound with the molecular formula C8H10Cl3NO and a molecular weight of 242.5 g/mol. IUPAC name: (1S)-2-amino-1-(3,4-dichlorophenyl)ethanol;hydrochloride. InChIKey: MDSYSOQCKJDTTE-DDWIOCJRSA-N.
| Molecular formula | C8H10Cl3NO |
|---|---|
| Molecular weight | 242.5 g/mol |
| IUPAC name | (1S)-2-amino-1-(3,4-dichlorophenyl)ethanol;hydrochloride |
| InChIKey | MDSYSOQCKJDTTE-DDWIOCJRSA-N |
| SMILES | C1=CC(=C(C=C1[C@@H](CN)O)Cl)Cl.Cl |
Computed by PubChem (NCBI)