CAS 19853-64-6 appears in our catalog under these names: 6,7–Dichloroquinoxaline, 6,7-Dichloroquinoxaline 95%, 6,7-Dichloroquinoxaline, 95%, 95%, 6,7-Dichloroquinoxaline, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
6,7-dichloroquinoxaline (CAS 19853-64-6) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 6,7-dichloroquinoxaline. InChIKey: YAVWRUWYXLAQRT-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 6,7-dichloroquinoxaline |
| InChIKey | YAVWRUWYXLAQRT-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C=C(C(=CC2=N1)Cl)Cl |
Computed by PubChem (NCBI)