Products 1989659-09-7
CAS 1989659-09-7 is the registry number for Methyl 2-(2,3-dichlorophenyl)-2-(methylamino)acetate hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Methyl 2-(2,3-dichlorophenyl)-2-(methylamino)acetate;hydrochloride (CAS 1989659-09-7) is a chemical compound with the molecular formula C10H12Cl3NO2 and a molecular weight of 284.6 g/mol. IUPAC name: methyl 2-(2,3-dichlorophenyl)-2-(methylamino)acetate;hydrochloride. InChIKey: JETYBXRORAHDHW-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl3NO2 |
|---|---|
| Molecular weight | 284.6 g/mol |
| IUPAC name | methyl 2-(2,3-dichlorophenyl)-2-(methylamino)acetate;hydrochloride |
| InChIKey | JETYBXRORAHDHW-UHFFFAOYSA-N |
| SMILES | CNC(C1=C(C(=CC=C1)Cl)Cl)C(=O)OC.Cl |
Computed by PubChem (NCBI)