Products 2010958-16-2

CAS 2010958-16-2 appears in our catalog under these names: 5–Methylpyrimidine–4,6–dicarboxylic acid, 5-Methylpyrimidine-4,6-dicarboxylic acid. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-methylpyrimidine-4,6-dicarboxylic acid (CAS 2010958-16-2) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 5-methylpyrimidine-4,6-dicarboxylic acid. InChIKey: YMLNPSXGIDFHPZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6N2O4
Molecular weight182.13 g/mol
IUPAC name5-methylpyrimidine-4,6-dicarboxylic acid
InChIKeyYMLNPSXGIDFHPZ-UHFFFAOYSA-N
SMILESCC1=C(N=CN=C1C(=O)O)C(=O)O

Computed by PubChem (NCBI)