Products 201489-21-6
CAS 201489-21-6 appears in our catalog under these names: Fmoc–Ala–OH–3–13C, Fmoc-Ala-OH-3-13C, Fmoc-Ala-OH-3-13C, 98.83%, Fmoc-Ala-OH-3-13C, 98%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 100mg, 250mg, 25mg, 50mg, 500mg, 25 mg, 50 mg, 100 mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)(313C)propanoic acid (CAS 201489-21-6) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 312.32 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)(313C)propanoic acid. InChIKey: QWXZOFZKSQXPDC-XEHHCZBASA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 312.32 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)(313C)propanoic acid |
| InChIKey | QWXZOFZKSQXPDC-XEHHCZBASA-N |
| SMILES | [13CH3][C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)