CAS 201612-65-9 is the registry number for Boc-L-Ala-OH-2-13C. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino](213C)propanoic acid (CAS 201612-65-9) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 190.20 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino](213C)propanoic acid. InChIKey: QVHJQCGUWFKTSE-IJPZVAHNSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino](213C)propanoic acid |
| InChIKey | QVHJQCGUWFKTSE-IJPZVAHNSA-N |
| SMILES | C[13C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)