Products 2028341-89-9

CAS 2028341-89-9 is the registry number for 8-(tert-Butyl) 4-ethyl 2,8-diazaspiro[4.5]decane-4,8-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg.

Structural formula: {0} (CAS {1})

8-O-tert-butyl 4-O-ethyl 2,8-diazaspiro[4.5]decane-4,8-dicarboxylate (CAS 2028341-89-9) is a chemical compound with the molecular formula C16H28N2O4 and a molecular weight of 312.40 g/mol. IUPAC name: 8-O-tert-butyl 4-O-ethyl 2,8-diazaspiro[4.5]decane-4,8-dicarboxylate. InChIKey: YLUFBPCSTFOULN-UHFFFAOYSA-N.

Identity
Molecular formulaC16H28N2O4
Molecular weight312.40 g/mol
IUPAC name8-O-tert-butyl 4-O-ethyl 2,8-diazaspiro[4.5]decane-4,8-dicarboxylate
InChIKeyYLUFBPCSTFOULN-UHFFFAOYSA-N
SMILESCCOC(=O)C1CNCC12CCN(CC2)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)