CAS 2036139-30-5 appears in our catalog under these names: Nintedanib Impurity 34, Nintedanib Impurity 16, methyl 3-(hydroxy(phenyl)methylene)-2-oxoindoline-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-benzoyl-2-hydroxy-1H-indole-6-carboxylate (CAS 2036139-30-5) is a chemical compound with the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. IUPAC name: methyl 3-benzoyl-2-hydroxy-1H-indole-6-carboxylate. InChIKey: CTAXHFYBNNGHNF-UHFFFAOYSA-N.
| Molecular formula | C17H13NO4 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | methyl 3-benzoyl-2-hydroxy-1H-indole-6-carboxylate |
| InChIKey | CTAXHFYBNNGHNF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C(=C(N2)O)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)