CAS 20443-71-4 appears in our catalog under these names: Ethyl 4-chlorobenzenesulfonate, 97%, Ethyl 4-chlorobenzenesulfonate, 95%+, 95%+, ETHYL 4-CHLOROBENZENE-1-SULFONATE, 95%+. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
Ethyl 4-chlorobenzenesulfonate (CAS 20443-71-4) is a chemical compound with the molecular formula C8H9ClO3S and a molecular weight of 220.67 g/mol. IUPAC name: ethyl 4-chlorobenzenesulfonate. InChIKey: NXEDTZGUAGKMJS-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO3S |
|---|---|
| Molecular weight | 220.67 g/mol |
| IUPAC name | ethyl 4-chlorobenzenesulfonate |
| InChIKey | NXEDTZGUAGKMJS-UHFFFAOYSA-N |
| SMILES | CCOS(=O)(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)