CAS 2050-19-3 is the registry number for diethyl 4–nitrobenzene–1,2–dicarboxylate. Offered by: GLPBio. Available pack sizes: 250mg.
Diethyl 4-nitrobenzene-1,2-dicarboxylate (CAS 2050-19-3) is a chemical compound with the molecular formula C12H13NO6 and a molecular weight of 267.23 g/mol. IUPAC name: diethyl 4-nitrobenzene-1,2-dicarboxylate. InChIKey: PHULZILVTOTTJK-UHFFFAOYSA-N.
| Molecular formula | C12H13NO6 |
|---|---|
| Molecular weight | 267.23 g/mol |
| IUPAC name | diethyl 4-nitrobenzene-1,2-dicarboxylate |
| InChIKey | PHULZILVTOTTJK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)[N+](=O)[O-])C(=O)OCC |
Computed by PubChem (NCBI)