Products 2090372-74-8

CAS 2090372-74-8 is the registry number for 4-Methyl-5-nitronicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-methyl-5-nitropyridine-3-carboxylic acid (CAS 2090372-74-8) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 4-methyl-5-nitropyridine-3-carboxylic acid. InChIKey: WINQHIDEUPIYIK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6N2O4
Molecular weight182.13 g/mol
IUPAC name4-methyl-5-nitropyridine-3-carboxylic acid
InChIKeyWINQHIDEUPIYIK-UHFFFAOYSA-N
SMILESCC1=C(C=NC=C1C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)