Products 2096336-15-9
CAS 2096336-15-9 appears in our catalog under these names: 4-tert-Butylcarbamoyl-2-chlorobenzeneboronic acid, ≥95%, ≥95%, 4-tert-Butylcarbamoyl-2-chlorobenzeneboronic acid, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
[4-(tert-butylcarbamoyl)-2-chlorophenyl]boronic acid (CAS 2096336-15-9) is a chemical compound with the molecular formula C11H15BClNO3 and a molecular weight of 255.51 g/mol. IUPAC name: [4-(tert-butylcarbamoyl)-2-chlorophenyl]boronic acid. InChIKey: KKYJLFNTZIOCSL-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO3 |
|---|---|
| Molecular weight | 255.51 g/mol |
| IUPAC name | [4-(tert-butylcarbamoyl)-2-chlorophenyl]boronic acid |
| InChIKey | KKYJLFNTZIOCSL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)NC(C)(C)C)Cl)(O)O |
Computed by PubChem (NCBI)