Products 2108848-16-2
CAS 2108848-16-2 appears in our catalog under these names: tert-butyl 2,7-diazaspiro[4.4]nonane-2-carboxylate oxalate, 95%, 95%, tert-Butyl 2,7-diazaspiro[4.4]nonane-2-carboxylate oxalate, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 2,7-diazaspiro[4.4]nonane-2-carboxylate;oxalic acid (CAS 2108848-16-2) is a chemical compound with the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. IUPAC name: tert-butyl 2,7-diazaspiro[4.4]nonane-2-carboxylate;oxalic acid. InChIKey: PLCOMGLWKQJESQ-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O6 |
|---|---|
| Molecular weight | 316.35 g/mol |
| IUPAC name | tert-butyl 2,7-diazaspiro[4.4]nonane-2-carboxylate;oxalic acid |
| InChIKey | PLCOMGLWKQJESQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)CCNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)