Products 2112661-94-4
CAS 2112661-94-4 is the registry number for Methyl 2-oxo-1H,2H-(1,3)oxazolo(5,4-c)pyridine-4-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 2-oxo-1H-[1,3]oxazolo[5,4-c]pyridine-4-carboxylate (CAS 2112661-94-4) is a chemical compound with the molecular formula C8H6N2O4 and a molecular weight of 194.14 g/mol. IUPAC name: methyl 2-oxo-1H-[1,3]oxazolo[5,4-c]pyridine-4-carboxylate. InChIKey: KNMPTTDVTDZZIM-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O4 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | methyl 2-oxo-1H-[1,3]oxazolo[5,4-c]pyridine-4-carboxylate |
| InChIKey | KNMPTTDVTDZZIM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=CC2=C1OC(=O)N2 |
Computed by PubChem (NCBI)