CAS 21345-28-8 appears in our catalog under these names: 4-(4-Ethylphenyl)phenol, 97%, 4′–Ethyl–biphenyl–4–ol, 4-(4-Ethylphenyl)phenol, ≥98%, ≥98%, 4'-Ethyl-biphenyl-4-ol, >=95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
4-(4-ethylphenyl)phenol (CAS 21345-28-8) is a chemical compound with the molecular formula C14H14O and a molecular weight of 198.26 g/mol. IUPAC name: 4-(4-ethylphenyl)phenol. InChIKey: MVHOIHXEJQPTQT-UHFFFAOYSA-N.
| Molecular formula | C14H14O |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 4-(4-ethylphenyl)phenol |
| InChIKey | MVHOIHXEJQPTQT-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)