CAS 2135442-61-2 appears in our catalog under these names: cis-2-phenylsulfanylcyclopropanecarboxylic acid, 97%, 97%, rel-(1R,2R)-2-(Phenylthio)cyclopropane-1-carboxylic acid, 95%. Offered by: Chemat, AmBeed. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Cis-(1R,2R)-2-phenylsulfanylcyclopropane-1-carboxylic acid (CAS 2135442-61-2) is a chemical compound with the molecular formula C10H10O2S and a molecular weight of 194.25 g/mol. IUPAC name: cis-(1R,2R)-2-phenylsulfanylcyclopropane-1-carboxylic acid. InChIKey: CCYWYCFSZCKDIN-DTWKUNHWSA-N.
| Molecular formula | C10H10O2S |
|---|---|
| Molecular weight | 194.25 g/mol |
| IUPAC name | cis-(1R,2R)-2-phenylsulfanylcyclopropane-1-carboxylic acid |
| InChIKey | CCYWYCFSZCKDIN-DTWKUNHWSA-N |
| SMILES | C1[C@@H]([C@@H]1SC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)