CAS 2138522-82-2 appears in our catalog under these names: 5,6-Difluoro-1,2,3,4-tetrahydroisoquinoline hydrochloride, 97%, 5,6-Difluoro-1,2,3,4-tetrahydroisoquinoline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5,6-difluoro-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 2138522-82-2) is a chemical compound with the molecular formula C9H10ClF2N and a molecular weight of 205.63 g/mol. IUPAC name: 5,6-difluoro-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: ZAQLDOHRKVKWTC-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2N |
|---|---|
| Molecular weight | 205.63 g/mol |
| IUPAC name | 5,6-difluoro-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | ZAQLDOHRKVKWTC-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C(=C(C=C2)F)F.Cl |
Computed by PubChem (NCBI)