Products 2169095-12-7
CAS 2169095-12-7 is the registry number for 3-(4-Chlorophenoxy)oxetane-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 10mg, 25mg.
3-(4-chlorophenoxy)oxetane-3-carboxylic acid (CAS 2169095-12-7) is a chemical compound with the molecular formula C10H9ClO4 and a molecular weight of 228.63 g/mol. IUPAC name: 3-(4-chlorophenoxy)oxetane-3-carboxylic acid. InChIKey: UOPBEPOHURLJQU-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO4 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | 3-(4-chlorophenoxy)oxetane-3-carboxylic acid |
| InChIKey | UOPBEPOHURLJQU-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C(=O)O)OC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)