Products 2171880-95-6
CAS 2171880-95-6 appears in our catalog under these names: 4-(4-methoxyphenyl)-2-oxabicyclo[2.1.1]hexane-5-carboxylic acid, 95%, 4-(4-methoxyphenyl)-2-oxabicyclo[2.1.1]hexane-5-carboxylic acid, 96%, 96%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g.
4-(4-methoxyphenyl)-2-oxabicyclo[2.1.1]hexane-5-carboxylic acid (CAS 2171880-95-6) is a chemical compound with the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. IUPAC name: 4-(4-methoxyphenyl)-2-oxabicyclo[2.1.1]hexane-5-carboxylic acid. InChIKey: PDVBBRCHGGBHOT-UHFFFAOYSA-N.
| Molecular formula | C13H14O4 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)-2-oxabicyclo[2.1.1]hexane-5-carboxylic acid |
| InChIKey | PDVBBRCHGGBHOT-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C23CC(C2C(=O)O)OC3 |
Computed by PubChem (NCBI)