CAS 2803661-15-4 appears in our catalog under these names: rel-(1R,4S,5S)-4-(4-methoxyphenyl)-2-oxabicyclo[2.1.1]hexane-5-carboxylic acid, 95%, rel-(1R,4S,5S)-4-(4-Methoxyphenyl)-2-oxabicyclo[2.1.1]hexane-5-carboxylic acid, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg.
(1R,4S,5S)-4-(4-methoxyphenyl)-2-oxabicyclo[2.1.1]hexane-5-carboxylic acid (CAS 2803661-15-4) is a chemical compound with the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. IUPAC name: (1R,4S,5S)-4-(4-methoxyphenyl)-2-oxabicyclo[2.1.1]hexane-5-carboxylic acid. InChIKey: PDVBBRCHGGBHOT-NTZNESFSSA-N.
| Molecular formula | C13H14O4 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | (1R,4S,5S)-4-(4-methoxyphenyl)-2-oxabicyclo[2.1.1]hexane-5-carboxylic acid |
| InChIKey | PDVBBRCHGGBHOT-NTZNESFSSA-N |
| SMILES | COC1=CC=C(C=C1)[C@]23C[C@H]([C@H]2C(=O)O)OC3 |
Computed by PubChem (NCBI)