CAS 2173997-20-9 is the registry number for 4-Acetyl-5-nitro-1,2-dihydropyridin-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-acetyl-5-nitro-1H-pyridin-2-one (CAS 2173997-20-9) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 4-acetyl-5-nitro-1H-pyridin-2-one. InChIKey: PVUSGPRCANOJSO-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 4-acetyl-5-nitro-1H-pyridin-2-one |
| InChIKey | PVUSGPRCANOJSO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=O)NC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)