Products 2186640-94-6
CAS 2186640-94-6 is the registry number for 4-Methoxy-7-(Thiophen-2-Yl)-2,3-Dihydro-1H-Inden-1-One, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg.
4-methoxy-7-thiophen-2-yl-2,3-dihydroinden-1-one (CAS 2186640-94-6) is a chemical compound with the molecular formula C14H12O2S and a molecular weight of 244.31 g/mol. IUPAC name: 4-methoxy-7-thiophen-2-yl-2,3-dihydroinden-1-one. InChIKey: WGAPHPNXNQWLDU-UHFFFAOYSA-N.
| Molecular formula | C14H12O2S |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | 4-methoxy-7-thiophen-2-yl-2,3-dihydroinden-1-one |
| InChIKey | WGAPHPNXNQWLDU-UHFFFAOYSA-N |
| SMILES | COC1=C2CCC(=O)C2=C(C=C1)C3=CC=CS3 |
Computed by PubChem (NCBI)