Products 21914-07-8
CAS 21914-07-8 is the registry number for 5,5-Diphenylbarbituric acid, 90.000000%. Offered by: MedChemExpress. Available pack sizes: 1 mg.
5,5-diphenyl-1,3-diazinane-2,4,6-trione (CAS 21914-07-8) is a chemical compound with the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. IUPAC name: 5,5-diphenyl-1,3-diazinane-2,4,6-trione. InChIKey: IKVPZYAOGOJTLK-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O3 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | 5,5-diphenyl-1,3-diazinane-2,4,6-trione |
| InChIKey | IKVPZYAOGOJTLK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C(=O)NC(=O)NC2=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
5,5-Diphenylbarbituric acid, Barbituric acid, 5,5-diphenyl-, 5,5-Diphenyl-2,4,6(1H,3H,5H)-pyrimidinetrione, 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5,5-diphenyl-, 5,5-diphenyl-1,3-diazinane-2,4,6-trione, diphenylbarbituric acid, Cambridge id 5240994, Barbituric acid,5-diphenyl-, Oprea1_285542, CBDivE_011414