CAS 21945-66-4 appears in our catalog under these names: Phenyl(m-tolyl)methanol, 95-<97%, Phenyl-m-tolyl-methanol, 98%, (3-Methylphenyl)(phenyl)methanol. Offered by: Hoffman Fine Chemicals, AmBeed, Biosynth. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 250mg, 50mg, 1000mg.
(3-methylphenyl)-phenylmethanol (CAS 21945-66-4) is a chemical compound with the molecular formula C14H14O and a molecular weight of 198.26 g/mol. IUPAC name: (3-methylphenyl)-phenylmethanol. InChIKey: OIBXYJGRPCDUBE-UHFFFAOYSA-N.
| Molecular formula | C14H14O |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | (3-methylphenyl)-phenylmethanol |
| InChIKey | OIBXYJGRPCDUBE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)