Products 21947-71-7
CAS 21947-71-7 appears in our catalog under these names: trans–Cinnamic anhydride, Trans-cinnamic anhydride, trans-Cinnamic anhydride, 98%, 98%, trans-Cinnamic anhydride, 98%. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress, Ambeed. Available pack sizes: 1mg, 50mg, 25mg, 100mg, 5mg, 10mg, 10 mg, 50 mg.
[(E)-3-phenylprop-2-enoyl] (E)-3-phenylprop-2-enoate (CAS 21947-71-7) is a chemical compound with the molecular formula C18H14O3 and a molecular weight of 278.3 g/mol. IUPAC name: [(E)-3-phenylprop-2-enoyl] (E)-3-phenylprop-2-enoate. InChIKey: FXEDRSGUZBCDMO-PHEQNACWSA-N.
| Molecular formula | C18H14O3 |
|---|---|
| Molecular weight | 278.3 g/mol |
| IUPAC name | [(E)-3-phenylprop-2-enoyl] (E)-3-phenylprop-2-enoate |
| InChIKey | FXEDRSGUZBCDMO-PHEQNACWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)OC(=O)/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
Cinnamic anhydride, Cinnamic acid anhydride, (E)-Cinnamic anhydride, 2-Propenoic acid, 3-phenyl-, anhydride, 2-Propenoic acid, 3-phenyl-, anhydride, (2E,2'E)-, 2-Propenoic acid, 3-phenyl-, 1,1'-anhydride, (2E,2'E)-, trans-Cinnamic anhydride, 3-Phenylacrylic anhydride, 2-Propenoic acid,3-phenyl-, 1,1'-anhydride, [(E)-3-phenylprop-2-enoyl] (E)-3-phenylprop-2-enoate