Products 538-56-7

CAS 538-56-7 is the registry number for 2-Propenoic acid,3-phenyl-, 1,1'-anhydride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

[(E)-3-phenylprop-2-enoyl] (E)-3-phenylprop-2-enoate (CAS 538-56-7) is a chemical compound with the molecular formula C18H14O3 and a molecular weight of 278.3 g/mol. IUPAC name: [(E)-3-phenylprop-2-enoyl] (E)-3-phenylprop-2-enoate. InChIKey: FXEDRSGUZBCDMO-PHEQNACWSA-N.

Identity
Molecular formulaC18H14O3
Molecular weight278.3 g/mol
IUPAC name[(E)-3-phenylprop-2-enoyl] (E)-3-phenylprop-2-enoate
InChIKeyFXEDRSGUZBCDMO-PHEQNACWSA-N
SMILESC1=CC=C(C=C1)/C=C/C(=O)OC(=O)/C=C/C2=CC=CC=C2

Computed by PubChem (NCBI)