CAS 538-56-7 is the registry number for 2-Propenoic acid,3-phenyl-, 1,1'-anhydride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
[(E)-3-phenylprop-2-enoyl] (E)-3-phenylprop-2-enoate (CAS 538-56-7) is a chemical compound with the molecular formula C18H14O3 and a molecular weight of 278.3 g/mol. IUPAC name: [(E)-3-phenylprop-2-enoyl] (E)-3-phenylprop-2-enoate. InChIKey: FXEDRSGUZBCDMO-PHEQNACWSA-N.
| Molecular formula | C18H14O3 |
|---|---|
| Molecular weight | 278.3 g/mol |
| IUPAC name | [(E)-3-phenylprop-2-enoyl] (E)-3-phenylprop-2-enoate |
| InChIKey | FXEDRSGUZBCDMO-PHEQNACWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)OC(=O)/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)