CAS 219508-17-5 is the registry number for 3-Chloro-1H-indole-6-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
3-chloro-1H-indole-6-carboxylic acid (CAS 219508-17-5) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 3-chloro-1H-indole-6-carboxylic acid. InChIKey: PZARQIQAMMARKR-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 3-chloro-1H-indole-6-carboxylic acid |
| InChIKey | PZARQIQAMMARKR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)NC=C2Cl |
Computed by PubChem (NCBI)