CAS 2213-63-0 appears in our catalog under these names: 2,3-Dichloroquinoxaline, 2,3–Dichloroquinoxaline, 2,3-Dichloroquinoxaline, 98% , 2,3-Dichloroquinoxaline, >98.0%(GC), 2,3-Dichloroquinoxaline, 97%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 10g, 25g, 5g, 100g, 500g, 50g, 250g, 1g.
2,3-dichloroquinoxaline (CAS 2213-63-0) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 2,3-dichloroquinoxaline. InChIKey: SPSSDDOTEZKOOV-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 2,3-dichloroquinoxaline |
| InChIKey | SPSSDDOTEZKOOV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(C(=N2)Cl)Cl |
Computed by PubChem (NCBI)