Products 221905-22-2
CAS 221905-22-2 is the registry number for 3-(1H-Indol-3-yl)-2,5-dihydro-1H-pyrrole-2,5-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(1H-indol-3-yl)pyrrole-2,5-dione (CAS 221905-22-2) is a chemical compound with the molecular formula C12H8N2O2 and a molecular weight of 212.20 g/mol. IUPAC name: 3-(1H-indol-3-yl)pyrrole-2,5-dione. InChIKey: NTNCGNYCVKZAAH-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O2 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 3-(1H-indol-3-yl)pyrrole-2,5-dione |
| InChIKey | NTNCGNYCVKZAAH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C3=CC(=O)NC3=O |
Computed by PubChem (NCBI)