Products 2219378-85-3
CAS 2219378-85-3 is the registry number for 3-(2,2-Difluorocyclopropyl)aniline hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(2,2-difluorocyclopropyl)aniline;hydrochloride (CAS 2219378-85-3) is a chemical compound with the molecular formula C9H10ClF2N and a molecular weight of 205.63 g/mol. IUPAC name: 3-(2,2-difluorocyclopropyl)aniline;hydrochloride. InChIKey: RBHMHPOREHYFDI-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2N |
|---|---|
| Molecular weight | 205.63 g/mol |
| IUPAC name | 3-(2,2-difluorocyclopropyl)aniline;hydrochloride |
| InChIKey | RBHMHPOREHYFDI-UHFFFAOYSA-N |
| SMILES | C1C(C1(F)F)C2=CC(=CC=C2)N.Cl |
Computed by PubChem (NCBI)